C13H20Cl2N4 — CID 102762649
[3,5-dichloro-6-(2,3,5-trimethylpiperidin-1-yl)-2-pyridinyl]hydrazine (PubChem CID 102762649) has the molecular formula C13H20Cl2N4 and a molecular weight of 303.24 g/mol. Its IUPAC name is [3,5-dichloro-6-(2,3,5-trimethylpiperidin-1-yl)-2-pyridinyl]hydrazine.
| Compound Name | [3,5-dichloro-6-(2,3,5-trimethylpiperidin-1-yl)-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 102762649 |
| Molecular Formula | C13H20Cl2N4 |
| Molecular Weight | 303.24 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | [3,5-dichloro-6-(2,3,5-trimethylpiperidin-1-yl)-2-pyridinyl]hydrazine |
| SMILES | CC1CC(C)C(C)N(c2nc(NN)c(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C13H20Cl2N4/c1-7-4-8(2)9(3)19(6-7)13-11(15)5-10(14)12(17-13)18-16/h5,7-9H,4,6,16H2,1-3H3,(H,17,18) |
| InChIKey | TUXPYMVTRKROMH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.24 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|