C11H13Cl2N5O2 — CID 102762240
4-(3,5-dichloro-6-hydrazinyl-2-pyridinyl)-3-ethylpiperazine-2,6-dione (PubChem CID 102762240) has the molecular formula C11H13Cl2N5O2 and a molecular weight of 318.16 g/mol. Its IUPAC name is 4-(3,5-dichloro-6-hydrazinyl-2-pyridinyl)-3-ethylpiperazine-2,6-dione.
| Compound Name | 4-(3,5-dichloro-6-hydrazinyl-2-pyridinyl)-3-ethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 102762240 |
| Molecular Formula | C11H13Cl2N5O2 |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 4-(3,5-dichloro-6-hydrazinyl-2-pyridinyl)-3-ethylpiperazine-2,6-dione |
| SMILES | CCC1C(=O)NC(=O)CN1c1nc(NN)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H13Cl2N5O2/c1-2-7-11(20)15-8(19)4-18(7)10-6(13)3-5(12)9(16-10)17-14/h3,7H,2,4,14H2,1H3,(H,16,17)(H,15,19,20) |
| InChIKey | ZCGCDDDLKQYVQD-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|