C10H13N7O4 — CID 80925457
3-ethyl-4-(6-hydrazinyl-5-nitropyrimidin-4-yl)piperazine-2,6-dione (PubChem CID 80925457) has the molecular formula C10H13N7O4 and a molecular weight of 295.26 g/mol. Its IUPAC name is 3-ethyl-4-(6-hydrazinyl-5-nitropyrimidin-4-yl)piperazine-2,6-dione.
| Compound Name | 3-ethyl-4-(6-hydrazinyl-5-nitropyrimidin-4-yl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 80925457 |
| Molecular Formula | C10H13N7O4 |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 3-ethyl-4-(6-hydrazinyl-5-nitropyrimidin-4-yl)piperazine-2,6-dione |
| SMILES | CCC1C(=O)NC(=O)CN1c1ncnc(NN)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H13N7O4/c1-2-5-10(19)14-6(18)3-16(5)9-7(17(20)21)8(15-11)12-4-13-9/h4-5H,2-3,11H2,1H3,(H,12,13,15)(H,14,18,19) |
| InChIKey | PJHNAMBMYISRFP-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 156.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|