C9H9Cl2N5O2 — CID 81037837
4-(3,6-dichloro-1,2,4-triazin-5-yl)-3-ethylpiperazine-2,6-dione (PubChem CID 81037837) has the molecular formula C9H9Cl2N5O2 and a molecular weight of 290.11 g/mol. Its IUPAC name is 4-(3,6-dichloro-1,2,4-triazin-5-yl)-3-ethylpiperazine-2,6-dione.
| Compound Name | 4-(3,6-dichloro-1,2,4-triazin-5-yl)-3-ethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 81037837 |
| Molecular Formula | C9H9Cl2N5O2 |
| Molecular Weight | 290.11 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | 4-(3,6-dichloro-1,2,4-triazin-5-yl)-3-ethylpiperazine-2,6-dione |
| SMILES | CCC1C(=O)NC(=O)CN1c1nc(Cl)nnc1Cl |
| InChI | InChI=1S/C9H9Cl2N5O2/c1-2-4-8(18)12-5(17)3-16(4)7-6(10)14-15-9(11)13-7/h4H,2-3H2,1H3,(H,12,17,18) |
| InChIKey | CXEHFTYXZGSCJL-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.11 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|