About 4-(4-bromo-1,3-thiazol-2-yl)-3-ethylpiperazine-2,6-dione
4-(4-bromo-1,3-thiazol-2-yl)-3-ethylpiperazine-2,6-dione (PubChem CID 79399309) has the molecular formula C9H10BrN3O2S
and a molecular weight of 304.17 g/mol. Its IUPAC name is 4-(4-bromo-1,3-thiazol-2-yl)-3-ethylpiperazine-2,6-dione.
Molecular Properties
| Compound Name | 4-(4-bromo-1,3-thiazol-2-yl)-3-ethylpiperazine-2,6-dione |
| PubChem CID | 79399309 |
| Molecular Formula | C9H10BrN3O2S |
| Molecular Weight | 304.17 g/mol |
| Exact Mass | 302.97 |
| IUPAC Name | 4-(4-bromo-1,3-thiazol-2-yl)-3-ethylpiperazine-2,6-dione |
| SMILES | CCC1C(=O)NC(=O)CN1c1nc(Br)cs1 |
| InChI | InChI=1S/C9H10BrN3O2S/c1-2-5-8(15)12-7(14)3-13(5)9-11-6(10)4-16-9/h4-5H,2-3H2,1H3,(H,12,14,15) |
| InChIKey | VVURMWJAUDEJNZ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.17 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-bromo-1,3-thiazol-2-yl)-3-ethylpiperazine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-bromo-1,3-thiazol-2-yl)-3-ethylpiperazine-2,6-dione?
The IUPAC name of 4-(4-bromo-1,3-thiazol-2-yl)-3-ethylpiperazine-2,6-dione (CID 79399309) is 4-(4-bromo-1,3-thiazol-2-yl)-3-ethylpiperazine-2,6-dione.
What is the SMILES notation for 4-(4-bromo-1,3-thiazol-2-yl)-3-ethylpiperazine-2,6-dione?
The canonical SMILES for 4-(4-bromo-1,3-thiazol-2-yl)-3-ethylpiperazine-2,6-dione is CCC1C(=O)NC(=O)CN1c1nc(Br)cs1.
What is the InChIKey of 4-(4-bromo-1,3-thiazol-2-yl)-3-ethylpiperazine-2,6-dione?
The InChIKey is VVURMWJAUDEJNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BrN3O2S/c1-2-5-8(15)12-7(14)3-13(5)9-11-6(10)4-16-9/h4-5H,2-3H2,1H3,(H,12,14,15).
What are the key properties of 4-(4-bromo-1,3-thiazol-2-yl)-3-ethylpiperazine-2,6-dione?
4-(4-bromo-1,3-thiazol-2-yl)-3-ethylpiperazine-2,6-dione has a molecular weight of 304.17 g/mol, XLogP of 1.15, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-bromo-1,3-thiazol-2-yl)-3-ethylpiperazine-2,6-dione is sourced from PubChem (CID 79399309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).