C11H14N4O3 — CID 113387881
3-ethyl-4-[5-(hydroxymethyl)pyrimidin-2-yl]piperazine-2,6-dione (PubChem CID 113387881) has the molecular formula C11H14N4O3 and a molecular weight of 250.26 g/mol. Its IUPAC name is 3-ethyl-4-[5-(hydroxymethyl)pyrimidin-2-yl]piperazine-2,6-dione.
| Compound Name | 3-ethyl-4-[5-(hydroxymethyl)pyrimidin-2-yl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 113387881 |
| Molecular Formula | C11H14N4O3 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 3-ethyl-4-[5-(hydroxymethyl)pyrimidin-2-yl]piperazine-2,6-dione |
| SMILES | CCC1C(=O)NC(=O)CN1c1ncc(CO)cn1 |
| InChI | InChI=1S/C11H14N4O3/c1-2-8-10(18)14-9(17)5-15(8)11-12-3-7(6-16)4-13-11/h3-4,8,16H,2,5-6H2,1H3,(H,14,17,18) |
| InChIKey | BQOXZNFHDUPFQJ-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|