C11H14ClN5O3 — CID 66069180
4-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)-3-ethylpiperazine-2,6-dione (PubChem CID 66069180) has the molecular formula C11H14ClN5O3 and a molecular weight of 299.72 g/mol. Its IUPAC name is 4-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)-3-ethylpiperazine-2,6-dione.
| Compound Name | 4-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)-3-ethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66069180 |
| Molecular Formula | C11H14ClN5O3 |
| Molecular Weight | 299.72 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 4-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)-3-ethylpiperazine-2,6-dione |
| SMILES | CCOc1nc(Cl)nc(N2CC(=O)NC(=O)C2CC)n1 |
| InChI | InChI=1S/C11H14ClN5O3/c1-3-6-8(19)13-7(18)5-17(6)10-14-9(12)15-11(16-10)20-4-2/h6H,3-5H2,1-2H3,(H,13,18,19) |
| InChIKey | LRNJQRLGLCDJPI-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.72 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|