C9H10ClN5O3 — CID 66073724
4-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)-3-methylpiperazine-2,6-dione (PubChem CID 66073724) has the molecular formula C9H10ClN5O3 and a molecular weight of 271.66 g/mol. Its IUPAC name is 4-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)-3-methylpiperazine-2,6-dione.
| Compound Name | 4-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)-3-methylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66073724 |
| Molecular Formula | C9H10ClN5O3 |
| Molecular Weight | 271.66 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 4-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)-3-methylpiperazine-2,6-dione |
| SMILES | COc1nc(Cl)nc(N2CC(=O)NC(=O)C2C)n1 |
| InChI | InChI=1S/C9H10ClN5O3/c1-4-6(17)11-5(16)3-15(4)8-12-7(10)13-9(14-8)18-2/h4H,3H2,1-2H3,(H,11,16,17) |
| InChIKey | GGHAVLVWSUWGCI-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.66 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|