C9H12ClN5O2 — CID 55124176
4-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)piperazin-2-one (PubChem CID 55124176) has the molecular formula C9H12ClN5O2 and a molecular weight of 257.68 g/mol. Its IUPAC name is 4-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)piperazin-2-one.
| Compound Name | 4-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)piperazin-2-one |
|---|---|
| PubChem CID | 55124176 |
| Molecular Formula | C9H12ClN5O2 |
| Molecular Weight | 257.68 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 4-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)piperazin-2-one |
| SMILES | CCOc1nc(Cl)nc(N2CCNC(=O)C2)n1 |
| InChI | InChI=1S/C9H12ClN5O2/c1-2-17-9-13-7(10)12-8(14-9)15-4-3-11-6(16)5-15/h2-5H2,1H3,(H,11,16) |
| InChIKey | HVEQXUZEEZLLAA-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.68 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |