C12H13Cl2N3O2 — CID 106890549
4-(4-amino-2,6-dichlorophenyl)-3-ethylpiperazine-2,6-dione (PubChem CID 106890549) has the molecular formula C12H13Cl2N3O2 and a molecular weight of 302.16 g/mol. Its IUPAC name is 4-(4-amino-2,6-dichlorophenyl)-3-ethylpiperazine-2,6-dione.
| Compound Name | 4-(4-amino-2,6-dichlorophenyl)-3-ethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 106890549 |
| Molecular Formula | C12H13Cl2N3O2 |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | 4-(4-amino-2,6-dichlorophenyl)-3-ethylpiperazine-2,6-dione |
| SMILES | CCC1C(=O)NC(=O)CN1c1c(Cl)cc(N)cc1Cl |
| InChI | InChI=1S/C12H13Cl2N3O2/c1-2-9-12(19)16-10(18)5-17(9)11-7(13)3-6(15)4-8(11)14/h3-4,9H,2,5,15H2,1H3,(H,16,18,19) |
| InChIKey | FOBSUVIETHEWLJ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|