C13H13ClN2O4 — CID 81152303
3-chloro-4-(2-ethyl-3,5-dioxopiperazin-1-yl)benzoic acid (PubChem CID 81152303) has the molecular formula C13H13ClN2O4 and a molecular weight of 296.71 g/mol. Its IUPAC name is 3-chloro-4-(2-ethyl-3,5-dioxopiperazin-1-yl)benzoic acid.
| Compound Name | 3-chloro-4-(2-ethyl-3,5-dioxopiperazin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 81152303 |
| Molecular Formula | C13H13ClN2O4 |
| Molecular Weight | 296.71 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 3-chloro-4-(2-ethyl-3,5-dioxopiperazin-1-yl)benzoic acid |
| SMILES | CCC1C(=O)NC(=O)CN1c1ccc(C(=O)O)cc1Cl |
| InChI | InChI=1S/C13H13ClN2O4/c1-2-9-12(18)15-11(17)6-16(9)10-4-3-7(13(19)20)5-8(10)14/h3-5,9H,2,6H2,1H3,(H,19,20)(H,15,17,18) |
| InChIKey | PTSGVOFOGKXAFY-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.71 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|