C14H18N2O3 — CID 66068935
3-ethyl-4-[2-[(1S)-1-hydroxyethyl]phenyl]piperazine-2,6-dione (PubChem CID 66068935) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 3-ethyl-4-[2-[(1S)-1-hydroxyethyl]phenyl]piperazine-2,6-dione.
| Compound Name | 3-ethyl-4-[2-[(1S)-1-hydroxyethyl]phenyl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 66068935 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 3-ethyl-4-[2-[(1S)-1-hydroxyethyl]phenyl]piperazine-2,6-dione |
| SMILES | CCC1C(=O)NC(=O)CN1c1ccccc1[C@H](C)O |
| InChI | InChI=1S/C14H18N2O3/c1-3-11-14(19)15-13(18)8-16(11)12-7-5-4-6-10(12)9(2)17/h4-7,9,11,17H,3,8H2,1-2H3,(H,15,18,19)/t9-,11?/m0/s1 |
| InChIKey | OJTOSOCAHPTRQT-FTNKSUMCSA-N |
| XLogP | 0.98 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|