C14H21NO — CID 63370962
(1S)-1-[2-(2-ethylpyrrolidin-1-yl)phenyl]ethanol (PubChem CID 63370962) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is (1S)-1-[2-(2-ethylpyrrolidin-1-yl)phenyl]ethanol.
| Compound Name | (1S)-1-[2-(2-ethylpyrrolidin-1-yl)phenyl]ethanol |
|---|---|
| PubChem CID | 63370962 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | (1S)-1-[2-(2-ethylpyrrolidin-1-yl)phenyl]ethanol |
| SMILES | CCC1CCCN1c1ccccc1[C@H](C)O |
| InChI | InChI=1S/C14H21NO/c1-3-12-7-6-10-15(12)14-9-5-4-8-13(14)11(2)16/h4-5,8-9,11-12,16H,3,6-7,10H2,1-2H3/t11-,12?/m0/s1 |
| InChIKey | APNHAOYTGLDEFR-PXYINDEMSA-N |
| XLogP | 3.12 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |