C14H20BrNO — CID 78939883
(1S)-1-[3-bromo-4-(2-ethylpyrrolidin-1-yl)phenyl]ethanol (PubChem CID 78939883) has the molecular formula C14H20BrNO and a molecular weight of 298.22 g/mol. Its IUPAC name is (1S)-1-[3-bromo-4-(2-ethylpyrrolidin-1-yl)phenyl]ethanol.
| Compound Name | (1S)-1-[3-bromo-4-(2-ethylpyrrolidin-1-yl)phenyl]ethanol |
|---|---|
| PubChem CID | 78939883 |
| Molecular Formula | C14H20BrNO |
| Molecular Weight | 298.22 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | (1S)-1-[3-bromo-4-(2-ethylpyrrolidin-1-yl)phenyl]ethanol |
| SMILES | CCC1CCCN1c1ccc([C@H](C)O)cc1Br |
| InChI | InChI=1S/C14H20BrNO/c1-3-12-5-4-8-16(12)14-7-6-11(10(2)17)9-13(14)15/h6-7,9-10,12,17H,3-5,8H2,1-2H3/t10-,12?/m0/s1 |
| InChIKey | ACXJFMLWXLHLGQ-NUHJPDEHSA-N |
| XLogP | 3.88 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.22 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|