C13H17NO — CID 60973642
2-(2-ethylpyrrolidin-1-yl)benzaldehyde (PubChem CID 60973642) has the molecular formula C13H17NO and a molecular weight of 203.29 g/mol. Its IUPAC name is 2-(2-ethylpyrrolidin-1-yl)benzaldehyde.
| Compound Name | 2-(2-ethylpyrrolidin-1-yl)benzaldehyde |
|---|---|
| PubChem CID | 60973642 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 2-(2-ethylpyrrolidin-1-yl)benzaldehyde |
| SMILES | CCC1CCCN1c1ccccc1C=O |
| InChI | InChI=1S/C13H17NO/c1-2-12-7-5-9-14(12)13-8-4-3-6-11(13)10-15/h3-4,6,8,10,12H,2,5,7,9H2,1H3 |
| InChIKey | LSRHNRPHZUBZKO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|