C14H19N3O3 — CID 79603828
4-[4-(1-aminoethyl)-3-hydroxyphenyl]-3-ethylpiperazine-2,6-dione (PubChem CID 79603828) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is 4-[4-(1-aminoethyl)-3-hydroxyphenyl]-3-ethylpiperazine-2,6-dione.
| Compound Name | 4-[4-(1-aminoethyl)-3-hydroxyphenyl]-3-ethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 79603828 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 4-[4-(1-aminoethyl)-3-hydroxyphenyl]-3-ethylpiperazine-2,6-dione |
| SMILES | CCC1C(=O)NC(=O)CN1c1ccc(C(C)N)c(O)c1 |
| InChI | InChI=1S/C14H19N3O3/c1-3-11-14(20)16-13(19)7-17(11)9-4-5-10(8(2)15)12(18)6-9/h4-6,8,11,18H,3,7,15H2,1-2H3,(H,16,19,20) |
| InChIKey | ZTCGXZOFALXCAD-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|