C13H17N3O3 — CID 79603571
4-[4-(1-aminoethyl)-3-hydroxyphenyl]-3-methylpiperazine-2,6-dione (PubChem CID 79603571) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is 4-[4-(1-aminoethyl)-3-hydroxyphenyl]-3-methylpiperazine-2,6-dione.
| Compound Name | 4-[4-(1-aminoethyl)-3-hydroxyphenyl]-3-methylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 79603571 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 4-[4-(1-aminoethyl)-3-hydroxyphenyl]-3-methylpiperazine-2,6-dione |
| SMILES | CC(N)c1ccc(N2CC(=O)NC(=O)C2C)cc1O |
| InChI | InChI=1S/C13H17N3O3/c1-7(14)10-4-3-9(5-11(10)17)16-6-12(18)15-13(19)8(16)2/h3-5,7-8,17H,6,14H2,1-2H3,(H,15,18,19) |
| InChIKey | GGSBSDKNIJUZSO-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|