C12H12N4O2 — CID 66068775
4-(2-ethyl-3,5-dioxopiperazin-1-yl)pyridine-2-carbonitrile (PubChem CID 66068775) has the molecular formula C12H12N4O2 and a molecular weight of 244.25 g/mol. Its IUPAC name is 4-(2-ethyl-3,5-dioxopiperazin-1-yl)pyridine-2-carbonitrile.
| Compound Name | 4-(2-ethyl-3,5-dioxopiperazin-1-yl)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 66068775 |
| Molecular Formula | C12H12N4O2 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 4-(2-ethyl-3,5-dioxopiperazin-1-yl)pyridine-2-carbonitrile |
| SMILES | CCC1C(=O)NC(=O)CN1c1ccnc(C#N)c1 |
| InChI | InChI=1S/C12H12N4O2/c1-2-10-12(18)15-11(17)7-16(10)9-3-4-14-8(5-9)6-13/h3-5,10H,2,7H2,1H3,(H,15,17,18) |
| InChIKey | YTOFNIRCDBIBFK-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|