C14H16N4O2 — CID 81060475
4-(2-ethyl-3,5-dioxopiperazin-1-yl)-2,6-dimethylpyridine-3-carbonitrile (PubChem CID 81060475) has the molecular formula C14H16N4O2 and a molecular weight of 272.31 g/mol. Its IUPAC name is 4-(2-ethyl-3,5-dioxopiperazin-1-yl)-2,6-dimethylpyridine-3-carbonitrile.
| Compound Name | 4-(2-ethyl-3,5-dioxopiperazin-1-yl)-2,6-dimethylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 81060475 |
| Molecular Formula | C14H16N4O2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 4-(2-ethyl-3,5-dioxopiperazin-1-yl)-2,6-dimethylpyridine-3-carbonitrile |
| SMILES | CCC1C(=O)NC(=O)CN1c1cc(C)nc(C)c1C#N |
| InChI | InChI=1S/C14H16N4O2/c1-4-11-14(20)17-13(19)7-18(11)12-5-8(2)16-9(3)10(12)6-15/h5,11H,4,7H2,1-3H3,(H,17,19,20) |
| InChIKey | HIEMXQYOHPBRKM-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|