C12H15N5O3 — CID 114406910
5-amino-6-(2-ethyl-3,5-dioxopiperazin-1-yl)pyridine-2-carboxamide (PubChem CID 114406910) has the molecular formula C12H15N5O3 and a molecular weight of 277.28 g/mol. Its IUPAC name is 5-amino-6-(2-ethyl-3,5-dioxopiperazin-1-yl)pyridine-2-carboxamide.
| Compound Name | 5-amino-6-(2-ethyl-3,5-dioxopiperazin-1-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 114406910 |
| Molecular Formula | C12H15N5O3 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 5-amino-6-(2-ethyl-3,5-dioxopiperazin-1-yl)pyridine-2-carboxamide |
| SMILES | CCC1C(=O)NC(=O)CN1c1nc(C(N)=O)ccc1N |
| InChI | InChI=1S/C12H15N5O3/c1-2-8-12(20)16-9(18)5-17(8)11-6(13)3-4-7(15-11)10(14)19/h3-4,8H,2,5,13H2,1H3,(H2,14,19)(H,16,18,20) |
| InChIKey | BUBUGOAXTJVJTQ-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 131.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|