C12H18FN5O — CID 80806637
1-[5-fluoro-2-(methylamino)pyrimidin-4-yl]-6-methylpiperidine-3-carboxamide (PubChem CID 80806637) has the molecular formula C12H18FN5O and a molecular weight of 267.31 g/mol. Its IUPAC name is 1-[5-fluoro-2-(methylamino)pyrimidin-4-yl]-6-methylpiperidine-3-carboxamide.
| Compound Name | 1-[5-fluoro-2-(methylamino)pyrimidin-4-yl]-6-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 80806637 |
| Molecular Formula | C12H18FN5O |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 1-[5-fluoro-2-(methylamino)pyrimidin-4-yl]-6-methylpiperidine-3-carboxamide |
| SMILES | CNc1ncc(F)c(N2CC(C(N)=O)CCC2C)n1 |
| InChI | InChI=1S/C12H18FN5O/c1-7-3-4-8(10(14)19)6-18(7)11-9(13)5-16-12(15-2)17-11/h5,7-8H,3-4,6H2,1-2H3,(H2,14,19)(H,15,16,17) |
| InChIKey | XBALSZDBJCXTEJ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |