C10H15FN4S — CID 80836377
5-fluoro-N-methyl-4-(3-methylthiomorpholin-4-yl)pyrimidin-2-amine (PubChem CID 80836377) has the molecular formula C10H15FN4S and a molecular weight of 242.32 g/mol. Its IUPAC name is 5-fluoro-N-methyl-4-(3-methylthiomorpholin-4-yl)pyrimidin-2-amine.
| Compound Name | 5-fluoro-N-methyl-4-(3-methylthiomorpholin-4-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 80836377 |
| Molecular Formula | C10H15FN4S |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 5-fluoro-N-methyl-4-(3-methylthiomorpholin-4-yl)pyrimidin-2-amine |
| SMILES | CNc1ncc(F)c(N2CCSCC2C)n1 |
| InChI | InChI=1S/C10H15FN4S/c1-7-6-16-4-3-15(7)9-8(11)5-13-10(12-2)14-9/h5,7H,3-4,6H2,1-2H3,(H,12,13,14) |
| InChIKey | YAXHJEVMENEHGM-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |