C13H22N4S — CID 80835791
5-methyl-4-(3-methylthiomorpholin-4-yl)-N-propylpyrimidin-2-amine (PubChem CID 80835791) has the molecular formula C13H22N4S and a molecular weight of 266.41 g/mol. Its IUPAC name is 5-methyl-4-(3-methylthiomorpholin-4-yl)-N-propylpyrimidin-2-amine.
| Compound Name | 5-methyl-4-(3-methylthiomorpholin-4-yl)-N-propylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80835791 |
| Molecular Formula | C13H22N4S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 5-methyl-4-(3-methylthiomorpholin-4-yl)-N-propylpyrimidin-2-amine |
| SMILES | CCCNc1ncc(C)c(N2CCSCC2C)n1 |
| InChI | InChI=1S/C13H22N4S/c1-4-5-14-13-15-8-10(2)12(16-13)17-6-7-18-9-11(17)3/h8,11H,4-7,9H2,1-3H3,(H,14,15,16) |
| InChIKey | FSKJGBVZAAWJAB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |