C11H18N4S2 — CID 80835888
N-methyl-2-methylsulfanyl-6-(3-methylthiomorpholin-4-yl)pyrimidin-4-amine (PubChem CID 80835888) has the molecular formula C11H18N4S2 and a molecular weight of 270.43 g/mol. Its IUPAC name is N-methyl-2-methylsulfanyl-6-(3-methylthiomorpholin-4-yl)pyrimidin-4-amine.
| Compound Name | N-methyl-2-methylsulfanyl-6-(3-methylthiomorpholin-4-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80835888 |
| Molecular Formula | C11H18N4S2 |
| Molecular Weight | 270.43 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | N-methyl-2-methylsulfanyl-6-(3-methylthiomorpholin-4-yl)pyrimidin-4-amine |
| SMILES | CNc1cc(N2CCSCC2C)nc(SC)n1 |
| InChI | InChI=1S/C11H18N4S2/c1-8-7-17-5-4-15(8)10-6-9(12-2)13-11(14-10)16-3/h6,8H,4-5,7H2,1-3H3,(H,12,13,14) |
| InChIKey | QOPTVETWZZXEEY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |