C15H21F2N3O — CID 63076453
1-[2,6-difluoro-4-(methylaminomethyl)phenyl]-6-methylpiperidine-3-carboxamide (PubChem CID 63076453) has the molecular formula C15H21F2N3O and a molecular weight of 297.35 g/mol. Its IUPAC name is 1-[2,6-difluoro-4-(methylaminomethyl)phenyl]-6-methylpiperidine-3-carboxamide.
| Compound Name | 1-[2,6-difluoro-4-(methylaminomethyl)phenyl]-6-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 63076453 |
| Molecular Formula | C15H21F2N3O |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 1-[2,6-difluoro-4-(methylaminomethyl)phenyl]-6-methylpiperidine-3-carboxamide |
| SMILES | CNCc1cc(F)c(N2CC(C(N)=O)CCC2C)c(F)c1 |
| InChI | InChI=1S/C15H21F2N3O/c1-9-3-4-11(15(18)21)8-20(9)14-12(16)5-10(7-19-2)6-13(14)17/h5-6,9,11,19H,3-4,7-8H2,1-2H3,(H2,18,21) |
| InChIKey | ZFFJVANHYTVRTG-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|