C16H18F2N2S — CID 63078033
1-[3,5-difluoro-4-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]-N-methylmethanamine (PubChem CID 63078033) has the molecular formula C16H18F2N2S and a molecular weight of 308.40 g/mol. Its IUPAC name is 1-[3,5-difluoro-4-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]-N-methylmethanamine.
| Compound Name | 1-[3,5-difluoro-4-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 63078033 |
| Molecular Formula | C16H18F2N2S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 1-[3,5-difluoro-4-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]-N-methylmethanamine |
| SMILES | CNCc1cc(F)c(N2CCc3sccc3C2C)c(F)c1 |
| InChI | InChI=1S/C16H18F2N2S/c1-10-12-4-6-21-15(12)3-5-20(10)16-13(17)7-11(9-19-2)8-14(16)18/h4,6-8,10,19H,3,5,9H2,1-2H3 |
| InChIKey | DHAUXLJMKXNSHM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|