C15H14FNOS — CID 55010524
3-fluoro-4-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)benzaldehyde (PubChem CID 55010524) has the molecular formula C15H14FNOS and a molecular weight of 275.35 g/mol. Its IUPAC name is 3-fluoro-4-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)benzaldehyde.
| Compound Name | 3-fluoro-4-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)benzaldehyde |
|---|---|
| PubChem CID | 55010524 |
| Molecular Formula | C15H14FNOS |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 3-fluoro-4-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)benzaldehyde |
| SMILES | CC1c2ccsc2CCN1c1ccc(C=O)cc1F |
| InChI | InChI=1S/C15H14FNOS/c1-10-12-5-7-19-15(12)4-6-17(10)14-3-2-11(9-18)8-13(14)16/h2-3,5,7-10H,4,6H2,1H3 |
| InChIKey | AMJMKVDANCUWQI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|