C16H19NOS — CID 55040315
[3-methyl-4-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]methanol (PubChem CID 55040315) has the molecular formula C16H19NOS and a molecular weight of 273.40 g/mol. Its IUPAC name is [3-methyl-4-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]methanol.
| Compound Name | [3-methyl-4-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]methanol |
|---|---|
| PubChem CID | 55040315 |
| Molecular Formula | C16H19NOS |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | [3-methyl-4-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]methanol |
| SMILES | Cc1cc(CO)ccc1N1CCc2sccc2C1C |
| InChI | InChI=1S/C16H19NOS/c1-11-9-13(10-18)3-4-15(11)17-7-5-16-14(12(17)2)6-8-19-16/h3-4,6,8-9,12,18H,5,7,10H2,1-2H3 |
| InChIKey | WNAFZFAHFSBFGS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|