C15H17ClN2S — CID 81233771
5-[5-(chloromethyl)-2-methyl-4-pyridinyl]-4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridine (PubChem CID 81233771) has the molecular formula C15H17ClN2S and a molecular weight of 292.84 g/mol. Its IUPAC name is 5-[5-(chloromethyl)-2-methyl-4-pyridinyl]-4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridine.
| Compound Name | 5-[5-(chloromethyl)-2-methyl-4-pyridinyl]-4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 81233771 |
| Molecular Formula | C15H17ClN2S |
| Molecular Weight | 292.84 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 5-[5-(chloromethyl)-2-methyl-4-pyridinyl]-4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridine |
| SMILES | Cc1cc(N2CCc3sccc3C2C)c(CCl)cn1 |
| InChI | InChI=1S/C15H17ClN2S/c1-10-7-14(12(8-16)9-17-10)18-5-3-15-13(11(18)2)4-6-19-15/h4,6-7,9,11H,3,5,8H2,1-2H3 |
| InChIKey | PCCNKWQPEOSWSH-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.84 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|