C14H14ClFN2S — CID 105383564
5-[4-(chloromethyl)-3-fluoro-2-pyridinyl]-4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridine (PubChem CID 105383564) has the molecular formula C14H14ClFN2S and a molecular weight of 296.80 g/mol. Its IUPAC name is 5-[4-(chloromethyl)-3-fluoro-2-pyridinyl]-4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridine.
| Compound Name | 5-[4-(chloromethyl)-3-fluoro-2-pyridinyl]-4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 105383564 |
| Molecular Formula | C14H14ClFN2S |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 5-[4-(chloromethyl)-3-fluoro-2-pyridinyl]-4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridine |
| SMILES | CC1c2ccsc2CCN1c1nccc(CCl)c1F |
| InChI | InChI=1S/C14H14ClFN2S/c1-9-11-4-7-19-12(11)3-6-18(9)14-13(16)10(8-15)2-5-17-14/h2,4-5,7,9H,3,6,8H2,1H3 |
| InChIKey | RSQPIWSGBPCVAF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|