C11H15Cl2N3O — CID 102755349
1-[3,5-dichloro-6-(methylamino)-2-pyridinyl]piperidin-4-ol (PubChem CID 102755349) has the molecular formula C11H15Cl2N3O and a molecular weight of 276.17 g/mol. Its IUPAC name is 1-[3,5-dichloro-6-(methylamino)-2-pyridinyl]piperidin-4-ol.
| Compound Name | 1-[3,5-dichloro-6-(methylamino)-2-pyridinyl]piperidin-4-ol |
|---|---|
| PubChem CID | 102755349 |
| Molecular Formula | C11H15Cl2N3O |
| Molecular Weight | 276.17 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 1-[3,5-dichloro-6-(methylamino)-2-pyridinyl]piperidin-4-ol |
| SMILES | CNc1nc(N2CCC(O)CC2)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H15Cl2N3O/c1-14-10-8(12)6-9(13)11(15-10)16-4-2-7(17)3-5-16/h6-7,17H,2-5H2,1H3,(H,14,15) |
| InChIKey | HQQTZHFTECDEQR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.17 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |