C10H12Cl2N4O — CID 102755341
4-[3,5-dichloro-6-(methylamino)-2-pyridinyl]piperazin-2-one (PubChem CID 102755341) has the molecular formula C10H12Cl2N4O and a molecular weight of 275.14 g/mol. Its IUPAC name is 4-[3,5-dichloro-6-(methylamino)-2-pyridinyl]piperazin-2-one.
| Compound Name | 4-[3,5-dichloro-6-(methylamino)-2-pyridinyl]piperazin-2-one |
|---|---|
| PubChem CID | 102755341 |
| Molecular Formula | C10H12Cl2N4O |
| Molecular Weight | 275.14 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 4-[3,5-dichloro-6-(methylamino)-2-pyridinyl]piperazin-2-one |
| SMILES | CNc1nc(N2CCNC(=O)C2)c(Cl)cc1Cl |
| InChI | InChI=1S/C10H12Cl2N4O/c1-13-9-6(11)4-7(12)10(15-9)16-3-2-14-8(17)5-16/h4H,2-3,5H2,1H3,(H,13,15)(H,14,17) |
| InChIKey | PMZCUKREUPGSPT-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.14 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |