C11H14Cl2N4O — CID 102755342
4-[3,5-dichloro-6-(ethylamino)-2-pyridinyl]piperazin-2-one (PubChem CID 102755342) has the molecular formula C11H14Cl2N4O and a molecular weight of 289.17 g/mol. Its IUPAC name is 4-[3,5-dichloro-6-(ethylamino)-2-pyridinyl]piperazin-2-one.
| Compound Name | 4-[3,5-dichloro-6-(ethylamino)-2-pyridinyl]piperazin-2-one |
|---|---|
| PubChem CID | 102755342 |
| Molecular Formula | C11H14Cl2N4O |
| Molecular Weight | 289.17 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 4-[3,5-dichloro-6-(ethylamino)-2-pyridinyl]piperazin-2-one |
| SMILES | CCNc1nc(N2CCNC(=O)C2)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H14Cl2N4O/c1-2-14-10-7(12)5-8(13)11(16-10)17-4-3-15-9(18)6-17/h5H,2-4,6H2,1H3,(H,14,16)(H,15,18) |
| InChIKey | WPBTYNVTLBINBX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.17 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |