C11H15Cl2N3O — CID 102755300
3,5-dichloro-N-ethyl-6-morpholin-4-ylpyridin-2-amine (PubChem CID 102755300) has the molecular formula C11H15Cl2N3O and a molecular weight of 276.17 g/mol. Its IUPAC name is 3,5-dichloro-N-ethyl-6-morpholin-4-ylpyridin-2-amine.
| Compound Name | 3,5-dichloro-N-ethyl-6-morpholin-4-ylpyridin-2-amine |
|---|---|
| PubChem CID | 102755300 |
| Molecular Formula | C11H15Cl2N3O |
| Molecular Weight | 276.17 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 3,5-dichloro-N-ethyl-6-morpholin-4-ylpyridin-2-amine |
| SMILES | CCNc1nc(N2CCOCC2)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H15Cl2N3O/c1-2-14-10-8(12)7-9(13)11(15-10)16-3-5-17-6-4-16/h7H,2-6H2,1H3,(H,14,15) |
| InChIKey | QHZYBGIVNRKJNG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.17 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |