C14H19Cl2N3 — CID 102759337
6-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-3,5-dichloro-N-ethylpyridin-2-amine (PubChem CID 102759337) has the molecular formula C14H19Cl2N3 and a molecular weight of 300.23 g/mol. Its IUPAC name is 6-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-3,5-dichloro-N-ethylpyridin-2-amine.
| Compound Name | 6-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-3,5-dichloro-N-ethylpyridin-2-amine |
|---|---|
| PubChem CID | 102759337 |
| Molecular Formula | C14H19Cl2N3 |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 6-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-3,5-dichloro-N-ethylpyridin-2-amine |
| SMILES | CCNc1nc(N2CC3CCCC3C2)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H19Cl2N3/c1-2-17-13-11(15)6-12(16)14(18-13)19-7-9-4-3-5-10(9)8-19/h6,9-10H,2-5,7-8H2,1H3,(H,17,18) |
| InChIKey | PWWGAECVXPHLEG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |