C9H11Cl2N3S — CID 102755362
3,5-dichloro-6-thiomorpholin-4-ylpyridin-2-amine (PubChem CID 102755362) has the molecular formula C9H11Cl2N3S and a molecular weight of 264.18 g/mol. Its IUPAC name is 3,5-dichloro-6-thiomorpholin-4-ylpyridin-2-amine.
| Compound Name | 3,5-dichloro-6-thiomorpholin-4-ylpyridin-2-amine |
|---|---|
| PubChem CID | 102755362 |
| Molecular Formula | C9H11Cl2N3S |
| Molecular Weight | 264.18 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | 3,5-dichloro-6-thiomorpholin-4-ylpyridin-2-amine |
| SMILES | Nc1nc(N2CCSCC2)c(Cl)cc1Cl |
| InChI | InChI=1S/C9H11Cl2N3S/c10-6-5-7(11)9(13-8(6)12)14-1-3-15-4-2-14/h5H,1-4H2,(H2,12,13) |
| InChIKey | KOQGSLWOFVBCNO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.18 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |