C11H15ClN4S — CID 166129466
5-chloro-2-cyclopropyl-6-thiomorpholin-4-ylpyrimidin-4-amine (PubChem CID 166129466) has the molecular formula C11H15ClN4S and a molecular weight of 270.79 g/mol. Its IUPAC name is 5-chloro-2-cyclopropyl-6-thiomorpholin-4-ylpyrimidin-4-amine.
| Compound Name | 5-chloro-2-cyclopropyl-6-thiomorpholin-4-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 166129466 |
| Molecular Formula | C11H15ClN4S |
| Molecular Weight | 270.79 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 5-chloro-2-cyclopropyl-6-thiomorpholin-4-ylpyrimidin-4-amine |
| SMILES | Nc1nc(C2CC2)nc(N2CCSCC2)c1Cl |
| InChI | InChI=1S/C11H15ClN4S/c12-8-9(13)14-10(7-1-2-7)15-11(8)16-3-5-17-6-4-16/h7H,1-6H2,(H2,13,14,15) |
| InChIKey | JOCXKEPGFOSNDD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.79 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |