C8H14N4S — CID 82234689
2-methyl-4-thiomorpholin-4-yl-1H-imidazol-5-amine (PubChem CID 82234689) has the molecular formula C8H14N4S and a molecular weight of 198.29 g/mol. Its IUPAC name is 2-methyl-4-thiomorpholin-4-yl-1H-imidazol-5-amine.
| Compound Name | 2-methyl-4-thiomorpholin-4-yl-1H-imidazol-5-amine |
|---|---|
| PubChem CID | 82234689 |
| Molecular Formula | C8H14N4S |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 2-methyl-4-thiomorpholin-4-yl-1H-imidazol-5-amine |
| SMILES | Cc1nc(N2CCSCC2)c(N)[nH]1 |
| InChI | InChI=1S/C8H14N4S/c1-6-10-7(9)8(11-6)12-2-4-13-5-3-12/h2-5,9H2,1H3,(H,10,11) |
| InChIKey | MOSNQIGMHOZASK-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |