C11H16N4S2 — CID 61097477
5,6-dimethyl-3-thiomorpholin-4-ylpyridazine-4-carbothioamide (PubChem CID 61097477) has the molecular formula C11H16N4S2 and a molecular weight of 268.41 g/mol. Its IUPAC name is 5,6-dimethyl-3-thiomorpholin-4-ylpyridazine-4-carbothioamide.
| Compound Name | 5,6-dimethyl-3-thiomorpholin-4-ylpyridazine-4-carbothioamide |
|---|---|
| PubChem CID | 61097477 |
| Molecular Formula | C11H16N4S2 |
| Molecular Weight | 268.41 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 5,6-dimethyl-3-thiomorpholin-4-ylpyridazine-4-carbothioamide |
| SMILES | Cc1nnc(N2CCSCC2)c(C(N)=S)c1C |
| InChI | InChI=1S/C11H16N4S2/c1-7-8(2)13-14-11(9(7)10(12)16)15-3-5-17-6-4-15/h3-6H2,1-2H3,(H2,12,16) |
| InChIKey | YGWGLFQMIQRBTB-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.41 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|