C10H10ClN5S — CID 61098476
3-(4-chloropyrazol-1-yl)-5,6-dimethylpyridazine-4-carbothioamide (PubChem CID 61098476) has the molecular formula C10H10ClN5S and a molecular weight of 267.75 g/mol. Its IUPAC name is 3-(4-chloropyrazol-1-yl)-5,6-dimethylpyridazine-4-carbothioamide.
| Compound Name | 3-(4-chloropyrazol-1-yl)-5,6-dimethylpyridazine-4-carbothioamide |
|---|---|
| PubChem CID | 61098476 |
| Molecular Formula | C10H10ClN5S |
| Molecular Weight | 267.75 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 3-(4-chloropyrazol-1-yl)-5,6-dimethylpyridazine-4-carbothioamide |
| SMILES | Cc1nnc(-n2cc(Cl)cn2)c(C(N)=S)c1C |
| InChI | InChI=1S/C10H10ClN5S/c1-5-6(2)14-15-10(8(5)9(12)17)16-4-7(11)3-13-16/h3-4H,1-2H3,(H2,12,17) |
| InChIKey | UKXMDFNYGYQOIM-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.75 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|