C14H14ClN3OS — CID 65126357
3-[(4-chlorophenyl)methoxy]-5,6-dimethylpyridazine-4-carbothioamide (PubChem CID 65126357) has the molecular formula C14H14ClN3OS and a molecular weight of 307.81 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methoxy]-5,6-dimethylpyridazine-4-carbothioamide.
| Compound Name | 3-[(4-chlorophenyl)methoxy]-5,6-dimethylpyridazine-4-carbothioamide |
|---|---|
| PubChem CID | 65126357 |
| Molecular Formula | C14H14ClN3OS |
| Molecular Weight | 307.81 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 3-[(4-chlorophenyl)methoxy]-5,6-dimethylpyridazine-4-carbothioamide |
| SMILES | Cc1nnc(OCc2ccc(Cl)cc2)c(C(N)=S)c1C |
| InChI | InChI=1S/C14H14ClN3OS/c1-8-9(2)17-18-14(12(8)13(16)20)19-7-10-3-5-11(15)6-4-10/h3-6H,7H2,1-2H3,(H2,16,20) |
| InChIKey | ZHEKLJCDAZZHDA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.81 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|