C13H12ClN3OS — CID 61098668
3-(3-chlorophenoxy)-5,6-dimethylpyridazine-4-carbothioamide (PubChem CID 61098668) has the molecular formula C13H12ClN3OS and a molecular weight of 293.78 g/mol. Its IUPAC name is 3-(3-chlorophenoxy)-5,6-dimethylpyridazine-4-carbothioamide.
| Compound Name | 3-(3-chlorophenoxy)-5,6-dimethylpyridazine-4-carbothioamide |
|---|---|
| PubChem CID | 61098668 |
| Molecular Formula | C13H12ClN3OS |
| Molecular Weight | 293.78 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 3-(3-chlorophenoxy)-5,6-dimethylpyridazine-4-carbothioamide |
| SMILES | Cc1nnc(Oc2cccc(Cl)c2)c(C(N)=S)c1C |
| InChI | InChI=1S/C13H12ClN3OS/c1-7-8(2)16-17-13(11(7)12(15)19)18-10-5-3-4-9(14)6-10/h3-6H,1-2H3,(H2,15,19) |
| InChIKey | ABLFIYGKRUYUKI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.78 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|