C17H17ClN2O3 — CID 162357623
ethyl 3-(3-chlorophenoxy)-5,6,7,8-tetrahydrocinnoline-4-carboxylate (PubChem CID 162357623) has the molecular formula C17H17ClN2O3 and a molecular weight of 332.79 g/mol. Its IUPAC name is ethyl 3-(3-chlorophenoxy)-5,6,7,8-tetrahydrocinnoline-4-carboxylate.
| Compound Name | ethyl 3-(3-chlorophenoxy)-5,6,7,8-tetrahydrocinnoline-4-carboxylate |
|---|---|
| PubChem CID | 162357623 |
| Molecular Formula | C17H17ClN2O3 |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | ethyl 3-(3-chlorophenoxy)-5,6,7,8-tetrahydrocinnoline-4-carboxylate |
| SMILES | CCOC(=O)c1c(Oc2cccc(Cl)c2)nnc2c1CCCC2 |
| InChI | InChI=1S/C17H17ClN2O3/c1-2-22-17(21)15-13-8-3-4-9-14(13)19-20-16(15)23-12-7-5-6-11(18)10-12/h5-7,10H,2-4,8-9H2,1H3 |
| InChIKey | FTNCHRMRFSKFMY-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |