C26H25F4N3O2 — CID 162357803
3-[3-(difluoromethyl)phenoxy]-N-[2-(2,4-dimethylphenyl)-2,2-difluoroethyl]-5,6,7,8-tetrahydrocinnoline-4-carboxamide (PubChem CID 162357803) has the molecular formula C26H25F4N3O2 and a molecular weight of 487.50 g/mol. Its IUPAC name is 3-[3-(difluoromethyl)phenoxy]-N-[2-(2,4-dimethylphenyl)-2,2-difluoroethyl]-5,6,7,8-tetrahydrocinnoline-4-carboxamide.
| Compound Name | 3-[3-(difluoromethyl)phenoxy]-N-[2-(2,4-dimethylphenyl)-2,2-difluoroethyl]-5,6,7,8-tetrahydrocinnoline-4-carboxamide |
|---|---|
| PubChem CID | 162357803 |
| Molecular Formula | C26H25F4N3O2 |
| Molecular Weight | 487.50 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | 3-[3-(difluoromethyl)phenoxy]-N-[2-(2,4-dimethylphenyl)-2,2-difluoroethyl]-5,6,7,8-tetrahydrocinnoline-4-carboxamide |
| SMILES | Cc1ccc(C(F)(F)CNC(=O)c2c(Oc3cccc(C(F)F)c3)nnc3c2CCCC3)c(C)c1 |
| InChI | InChI=1S/C26H25F4N3O2/c1-15-10-11-20(16(2)12-15)26(29,30)14-31-24(34)22-19-8-3-4-9-21(19)32-33-25(22)35-18-7-5-6-17(13-18)23(27)28/h5-7,10-13,23H,3-4,8-9,14H2,1-2H3,(H,31,34) |
| InChIKey | HMCHZAHUJKVDLA-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.50 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |