C26H24F5N3O3 — CID 162357593
N-[2-(2,4-dimethylphenyl)-2,2-difluoroethyl]-3-[3-(trifluoromethyl)phenoxy]-5,6,8,9-tetrahydrooxepino[4,5-c]pyridazine-4-carboxamide (PubChem CID 162357593) has the molecular formula C26H24F5N3O3 and a molecular weight of 521.49 g/mol. Its IUPAC name is N-[2-(2,4-dimethylphenyl)-2,2-difluoroethyl]-3-[3-(trifluoromethyl)phenoxy]-5,6,8,9-tetrahydrooxepino[4,5-c]pyridazine-4-carboxamide.
| Compound Name | N-[2-(2,4-dimethylphenyl)-2,2-difluoroethyl]-3-[3-(trifluoromethyl)phenoxy]-5,6,8,9-tetrahydrooxepino[4,5-c]pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 162357593 |
| Molecular Formula | C26H24F5N3O3 |
| Molecular Weight | 521.49 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | N-[2-(2,4-dimethylphenyl)-2,2-difluoroethyl]-3-[3-(trifluoromethyl)phenoxy]-5,6,8,9-tetrahydrooxepino[4,5-c]pyridazine-4-carboxamide |
| SMILES | Cc1ccc(C(F)(F)CNC(=O)c2c(Oc3cccc(C(F)(F)F)c3)nnc3c2CCOCC3)c(C)c1 |
| InChI | InChI=1S/C26H24F5N3O3/c1-15-6-7-20(16(2)12-15)25(27,28)14-32-23(35)22-19-8-10-36-11-9-21(19)33-34-24(22)37-18-5-3-4-17(13-18)26(29,30)31/h3-7,12-13H,8-11,14H2,1-2H3,(H,32,35) |
| InChIKey | IQNNQWRFLRETIH-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.49 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |