C15H23N5S — CID 79928245
5,6-dimethyl-3-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)pyridazine-4-carbothioamide (PubChem CID 79928245) has the molecular formula C15H23N5S and a molecular weight of 305.45 g/mol. Its IUPAC name is 5,6-dimethyl-3-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)pyridazine-4-carbothioamide.
| Compound Name | 5,6-dimethyl-3-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)pyridazine-4-carbothioamide |
|---|---|
| PubChem CID | 79928245 |
| Molecular Formula | C15H23N5S |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 5,6-dimethyl-3-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)pyridazine-4-carbothioamide |
| SMILES | Cc1nnc(N2CC3CCCN3CC2C)c(C(N)=S)c1C |
| InChI | InChI=1S/C15H23N5S/c1-9-7-19-6-4-5-12(19)8-20(9)15-13(14(16)21)10(2)11(3)17-18-15/h9,12H,4-8H2,1-3H3,(H2,16,21) |
| InChIKey | VVVQIUFPICLOPC-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|