C9H16N4S — CID 82234699
2-methyl-4-(1,4-thiazepan-4-yl)-1H-imidazol-5-amine (PubChem CID 82234699) has the molecular formula C9H16N4S and a molecular weight of 212.32 g/mol. Its IUPAC name is 2-methyl-4-(1,4-thiazepan-4-yl)-1H-imidazol-5-amine.
| Compound Name | 2-methyl-4-(1,4-thiazepan-4-yl)-1H-imidazol-5-amine |
|---|---|
| PubChem CID | 82234699 |
| Molecular Formula | C9H16N4S |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 2-methyl-4-(1,4-thiazepan-4-yl)-1H-imidazol-5-amine |
| SMILES | Cc1nc(N2CCCSCC2)c(N)[nH]1 |
| InChI | InChI=1S/C9H16N4S/c1-7-11-8(10)9(12-7)13-3-2-5-14-6-4-13/h2-6,10H2,1H3,(H,11,12) |
| InChIKey | MCVQGSMXYKJSEQ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |