C8H13N3S2 — CID 130619166
4-(5-methyl-1,3,4-thiadiazol-2-yl)-1,4-thiazepane (PubChem CID 130619166) has the molecular formula C8H13N3S2 and a molecular weight of 215.35 g/mol. Its IUPAC name is 4-(5-methyl-1,3,4-thiadiazol-2-yl)-1,4-thiazepane.
| Compound Name | 4-(5-methyl-1,3,4-thiadiazol-2-yl)-1,4-thiazepane |
|---|---|
| PubChem CID | 130619166 |
| Molecular Formula | C8H13N3S2 |
| Molecular Weight | 215.35 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 4-(5-methyl-1,3,4-thiadiazol-2-yl)-1,4-thiazepane |
| SMILES | Cc1nnc(N2CCCSCC2)s1 |
| InChI | InChI=1S/C8H13N3S2/c1-7-9-10-8(13-7)11-3-2-5-12-6-4-11/h2-6H2,1H3 |
| InChIKey | WEUNXYHPGYZVCE-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.35 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |