C10H17BrN4S — CID 80666788
2-[4-(2-bromoethyl)-1,4-diazepan-1-yl]-5-methyl-1,3,4-thiadiazole (PubChem CID 80666788) has the molecular formula C10H17BrN4S and a molecular weight of 305.25 g/mol. Its IUPAC name is 2-[4-(2-bromoethyl)-1,4-diazepan-1-yl]-5-methyl-1,3,4-thiadiazole.
| Compound Name | 2-[4-(2-bromoethyl)-1,4-diazepan-1-yl]-5-methyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 80666788 |
| Molecular Formula | C10H17BrN4S |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 2-[4-(2-bromoethyl)-1,4-diazepan-1-yl]-5-methyl-1,3,4-thiadiazole |
| SMILES | Cc1nnc(N2CCCN(CCBr)CC2)s1 |
| InChI | InChI=1S/C10H17BrN4S/c1-9-12-13-10(16-9)15-5-2-4-14(6-3-11)7-8-15/h2-8H2,1H3 |
| InChIKey | CLRYFSOSNQIGLO-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|