C9H16BrN3S — CID 80669751
N-(2-bromoethyl)-N-butyl-5-methyl-1,3,4-thiadiazol-2-amine (PubChem CID 80669751) has the molecular formula C9H16BrN3S and a molecular weight of 278.22 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-butyl-5-methyl-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(2-bromoethyl)-N-butyl-5-methyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 80669751 |
| Molecular Formula | C9H16BrN3S |
| Molecular Weight | 278.22 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | N-(2-bromoethyl)-N-butyl-5-methyl-1,3,4-thiadiazol-2-amine |
| SMILES | CCCCN(CCBr)c1nnc(C)s1 |
| InChI | InChI=1S/C9H16BrN3S/c1-3-4-6-13(7-5-10)9-12-11-8(2)14-9/h3-7H2,1-2H3 |
| InChIKey | OMJBVQSYHBYYEK-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.22 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|